| Name | Prenyl acetate |
| Synonyms | BRN 1746265 PRENYL ACETATE Prenyl acetate VERTENOL-ACETATE 3-methyl-2-butenyl Dimethylallyl acetate Isopent-2-enyl acetate ISOPENT-2-ENYL ACETATE 3,3-Dimethylallyl acetate 3,3-DIMETHYLALLYL ACETATE 3-Methyl-2-butenyl acetate 3-methyl-2-buten-1-oacetate 3-methyl, but-2-enyl acetate 3-methylbut-2-en-1-yl acetate 3-Methyl-2-buten-1-ol, acetate 3-methyl-but-2-en-1-yl acetate 2-Buten-1-ol, 3-methyl-, acetate 2-Buten-1-ol, 3-methyl-, 1-acetate |
| CAS | 1191-16-8 |
| EINECS | 214-730-4 |
| InChI | InChI=1/C7H12O2/c1-6(2)4-5-9-7(3)8/h4H,5H2,1-3H3 |
| InChIKey | XXIKYCPRDXIMQM-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
| Molar Mass | 128.17 |
| Density | 0.917g/mLat 25°C(lit.) |
| Melting Point | -62.68°C (estimate) |
| Boling Point | 151-152°C752mm Hg(lit.) |
| Flash Point | 121°F |
| JECFA Number | 1827 |
| Water Solubility | 4.3g/L at 20℃ |
| Solubility | H2O: insoluble |
| Vapor Presure | 2.6hPa at 20℃ |
| Appearance | neat |
| Specific Gravity | 0.917 |
| Color | Colorless to Almost colorless |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.43(lit.) |
| MDL | MFCD00036569 |
| Risk Codes | 10 - Flammable |
| Safety Description | S16 - Keep away from sources of ignition. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 3272 3/PG 3 |
| WGK Germany | 2 |
| RTECS | EM9473700 |
| TSCA | Yes |
| HS Code | 29153900 |
| Hazard Class | 3 |
| Packing Group | III |
| FEMA | 4202 | PRENYL ACETATE |
| LogP | 2 at 23℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |